Poricoic acid B Inhibitor

Solid. Powder

98.00%

Store at -20 degree C for 3 years powder
-80 degree C for 2 years in solvent

484.67

<1mg/ml refers to the product slightly soluble or insoluble

C30H44O5

C[C@@](C1)([C@](C)(CC=C2[C@@]3(C)CCC(O)=O)[C@@H]([C@@H](CCC=C(C)C)C(O)=O)[C@@H]1O)C2=CC[C@H]3C(C)=C

137551-39-4

Others

These two, and eight other known compounds isolated from the sclerotium, Poricoic acid B (3), poricoic acid A (4), tumulosic acid (5), dehydrotumulosic acid (6), 3-epidehydrotumulosic acid (7), polyporenic acid C (8), 25-hydroxy-3-epidehydrotumulosic acid (9), and dehydroabietic acid methyl ester (10), showed potent inhibitory effects on Epstein-Barr virus early antigen (EBV-EA) activation induced by the tumor promoter 12-O-tetradecanoylphorbol-13-acetate (TPA). Evaluation of the cytotoxicity of compounds 1 and 4 against human cancer cell lines revealed that 1 was significantly cytotoxic to leukemia HL-60 cells [GI(50) (concentration that yields 50% growth) value 39.3nM], although it showed only moderate cytotoxicity to the other cells. Compound 4 exhibited moderate cytotoxicity to all of the cancer cell lines tested.